Telecom-Band Entanglement Generation for Chipscale Quantum Processing
| dc.creator | Lee, Kim Fook | |
| dc.creator | Kumar, Prem | |
| dc.creator | Sharping, Jay E. | |
| dc.creator | Foster, Mark A. | |
| dc.creator | Gaeta, Alexander L. | |
| dc.creator | Turner, Amy C. | |
| dc.creator | Lipson, Michal | |
| dc.date | 2008-01-17 | |
| dc.date.accessioned | 2026-07-07T08:54:57Z | |
| dc.date.available | 2026-07-07T08:54:57Z | |
| dc.description | We demonstrate polarization-entanglement for non-degenerate and degenerate photon-pairs generated through Kerr-nonlinearity in a nano-scale silicon-on-insulator(SOI) waveguide. We use a compact counter propagating configuration to create two-photon polarization-entangled state, |H>|H> + |V>|V>. We observe two-photon interference with visibility > 91% and > 80% for non-degenerate and degenerate photon-pairs, respectively. The experimental structure can be implemented on optical chips as an integrated source of entangled photons for future quantum computer and communication applications. | |
| dc.description | 9 pages, 3 figures | |
| dc.identifier | https://arxiv.org/abs/0801.2606 | |
| dc.identifier | http://arxiv.org/abs/0801.2606 | |
| dc.identifier.uri | http://salesiana.dossiersoluciones.com/handle/123456789/146127 | |
| dc.subject | Quantum Physics | |
| dc.title | Telecom-Band Entanglement Generation for Chipscale Quantum Processing | |
| dc.type | text |